Database Results
Page 12 of 1850 compounds
dibenzyl ether
Acyclic ethersCAS Number
103-50-4
SMILES String
C1=CC=C(C=C1)COCC2=CC=CC=C2
Chemical Properties
| Property | Measured | Predicted |
|---|---|---|
| Research Octane Number (-) | - | 98.09 |
| Motor Octane Number (-) | - | 88.01 |
| Cetane Number (-) | 8.1 | 5.919 |
| Derived Cetane Number (-) | 8.1 | 7.695 |
| Yield Sooting Index (-) | - | 346.5 |
| Upper Flammability Limit (vol.%) | 6 | 5.925 |
| Lower Flammability Limit (vol.%) | 0.6 | 0.8162 |
| Lower Heating Value (kJ/mol) | -7145 | -7044 |
Physical Properties
| Property | Measured | Predicted |
|---|---|---|
| Density (g/cm3@15~30°C) | 1.043 | 1.05 |
| Boiling Point (°C) | 298 | 291 |
| Melting Point (°C) | 1.8 | 20.04 |
| Viscosity (mPa*s@20°C) | 5.33 | 13.93 |
| Enthalpy of Vaporization (kJ/mol@25°C) | - | 70.53 |
| Standard Enthalpy of Formation (kJ/mol@25°C) | - | -91.51 |
| Vapor Pressure (kPa@25°C) | 0.000137 | 6.015e-05 |
| Surface Tension (dyne/cm@25°C) | - | 37.35 |
| Flash Point (°C) | 135 | 123.8 |