Database Results
Page 7 of 1850 compounds
diphenyl ether
Acyclic ethersCAS Number
101-84-8
SMILES String
C1=CC=C(C=C1)OC2=CC=CC=C2
Chemical Properties
| Property | Measured | Predicted |
|---|---|---|
| Research Octane Number (-) | - | 97.55 |
| Motor Octane Number (-) | - | 91.44 |
| Cetane Number (-) | - | 14.35 |
| Derived Cetane Number (-) | - | 10.9 |
| Yield Sooting Index (-) | 241.4 | 282 |
| Upper Flammability Limit (vol.%) | 6 | 5.931 |
| Lower Flammability Limit (vol.%) | 0.8 | 0.905 |
| Lower Heating Value (kJ/mol) | -5894 | -5965 |
Physical Properties
| Property | Measured | Predicted |
|---|---|---|
| Density (g/cm3@15~30°C) | 1.066 | 1.066 |
| Boiling Point (°C) | 258 | 261.1 |
| Melting Point (°C) | 26.86 | 20.23 |
| Viscosity (mPa*s@20°C) | - | 4.938 |
| Enthalpy of Vaporization (kJ/mol@25°C) | - | 63.24 |
| Standard Enthalpy of Formation (kJ/mol@25°C) | - | -32.76 |
| Vapor Pressure (kPa@25°C) | 0.00284 | 0.001614 |
| Surface Tension (dyne/cm@25°C) | 38.82 | 37.53 |
| Flash Point (°C) | 112 | 115.6 |